CAS 3005-50-3
:1,1′-Sulfinylbis[1H-imidazole]
Description:
1,1′-Sulfinylbis[1H-imidazole] is a chemical compound characterized by its unique structure, which features two imidazole rings connected by a sulfinyl (-S(=O)-) group. This compound is known for its potential applications in various fields, including medicinal chemistry and biochemistry, due to the presence of the imidazole moiety, which is often found in biologically active molecules. The sulfinyl group can influence the compound's reactivity and solubility, making it an interesting subject for research. Typically, compounds like 1,1′-Sulfinylbis[1H-imidazole] exhibit properties such as moderate stability under standard conditions, and they may participate in redox reactions due to the presence of sulfur. Additionally, the imidazole rings can engage in hydrogen bonding and coordination with metal ions, which may enhance their biological activity. Overall, this compound represents a fascinating intersection of organic chemistry and pharmacology, warranting further investigation into its properties and potential uses.
Formula:C6H6N4OS
InChI:InChI=1S/C6H6N4OS/c11-12(9-3-1-7-5-9)10-4-2-8-6-10/h1-6H
InChI key:InChIKey=CNJBTSUNQWPABV-UHFFFAOYSA-N
SMILES:S(=O)(N1C=CN=C1)N2C=CN=C2
Synonyms:- 1H-Imidazole, 1,1′-sulfinylbis-
- 1,1′-Thionylbisimidazole
- 1,1′-Sulfinyldiimidazole
- Imidazole, 1,1′-sulfinyldi-
- 1,1′-Sulfinylbis[1H-imidazole]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
