CymitQuimica logo

CAS 3005-61-6

:

L-Phenylalanine, N-benzoyl-, methyl ester

Description:
L-Phenylalanine, N-benzoyl-, methyl ester, with the CAS number 3005-61-6, is an organic compound that belongs to the class of amino acid derivatives. It is characterized by the presence of a phenylalanine backbone, which is an essential amino acid, modified by the addition of a benzoyl group and a methyl ester functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water. The presence of the benzoyl group enhances its lipophilicity, which can influence its biological activity and interactions. L-Phenylalanine is known for its role in protein synthesis and as a precursor to neurotransmitters. The methyl ester form may exhibit different reactivity and stability compared to its free acid counterpart. As with many chemical substances, handling should be done with care, considering potential health effects and environmental impact.
Formula:C17H17NO3
InChI:InChI=1S/C17H17NO3/c1-21-17(20)15(12-13-8-4-2-5-9-13)18-16(19)14-10-6-3-7-11-14/h2-11,15H,12H2,1H3,(H,18,19)/t15-/m0/s1
InChI key:BRQQPHKRRCUYLA-HNNXBMFYSA-N
SMILES:COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C2=CC=CC=C2
Found 2 products.