CAS 3005-68-3
:3-Phenylproline
Description:
3-Phenylproline is an amino acid derivative characterized by its proline backbone with a phenyl group attached to the third carbon. This compound is classified as a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. It exhibits a unique cyclic structure due to the presence of the pyrrolidine ring, which contributes to its conformational rigidity. The phenyl group enhances its hydrophobic characteristics, influencing its solubility and interactions in biological systems. 3-Phenylproline has been studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals and as a building block in organic synthesis. Its stereochemistry is significant, as the presence of chiral centers can lead to different biological activities. Additionally, this compound may exhibit interesting properties such as the ability to act as a ligand or catalyst in various chemical reactions. Overall, 3-Phenylproline is a compound of interest in both synthetic and biological chemistry due to its structural features and potential applications.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c13-11(14)10-9(6-7-12-10)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)
InChI key:InChIKey=VDEMEKSASUGYHM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(CCN1)C2=CC=CC=C2
Synonyms:- 3-Phenylpyrrolidine-2-carboxylic acid
- 3-Phenylpyrrolidine-2-carboxylicacid
- Proline, 3-phenyl-
- 3-Phenylproline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Phenylpyrrolidine-2-carboxylic acid
CAS:3-Phenylpyrrolidine-2-carboxylic acid is a peptidomimetic that has been shown to have high affinity for melanocortin receptors. It is an agonist of the melanocortin receptor MC3 and MC4. 3-Phenylpyrrolidine-2-carboxylic acid has been synthesized, and its pharmacological properties have been simulated using molecular dynamic simulations. The molecule has a carbonyl group in the skeleton, which allows it to form steric interactions with the receptor. These interactions are important for the activation of the receptor by 3-Phenylpyrrolidine-2-carboxylic acid.
Formula:C11H13NO2Purity:Min. 95%Molecular weight:191.23 g/molRef: 3D-DAA00568
Discontinued product

