CAS 300541-91-7

4-morpholino-3-nitrobenzaldehyde

Description:

4-Morpholino-3-nitrobenzaldehyde is an organic compound characterized by its aromatic structure, featuring a nitro group and an aldehyde functional group. The presence of the morpholino group, which is a six-membered ring containing both nitrogen and oxygen, contributes to its unique chemical properties, including enhanced solubility in polar solvents. This compound typically appears as a yellow to orange crystalline solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The nitro group introduces electron-withdrawing characteristics, which can influence the reactivity of the compound in various chemical reactions, such as nucleophilic substitutions. Additionally, the aldehyde functional group can participate in condensation reactions, making it a versatile intermediate in organic synthesis. Safety data indicates that appropriate handling and storage conditions should be observed due to its potential toxicity and reactivity. Overall, 4-morpholino-3-nitrobenzaldehyde is a significant compound in research and industrial applications, particularly in the synthesis of more complex organic molecules.

Formula: C₁₁H₁₂N₂O₄

InChI: InChI=1/C11H12N2O4/c14-8-9-1-2-10(11(7-9)13(15)16)12-3-5-17-6-4-12/h1-2,7-8H,3-6H2

SMILES: c1cc(c(cc1C=O)N(=O)=O)N1CCOCC1

Synonyms:

• 4-Morpholin-4-Yl-3-Nitrobenzaldehyde

4-(4-Morpholino)-3-nitrobenzaldehyde

CAS: 300541-91-7

Formula: C₁₁H₁₂N₂O₄

Purity: 95%

Molecular weight: 236.2240

Ref: IN-DA00BD1F

4-(Morpholin-4-yl)-3-nitrobenzaldehyde

CAS: 300541-91-7

4-(Morpholin-4-yl)-3-nitrobenzaldehyde

Formula: C₁₁H₁₂N₂O₄

Purity: ≥95%

Color and Shape: solid

Molecular weight: 236.22g/mol

Ref: 54-OR0662

4-Morpholino-3-nitrobenzenecarbaldehyde

CAS: 300541-91-7

Versatile small molecule scaffold

Formula: C₁₁H₁₂N₂O₄

Purity: Min. 95%

Molecular weight: 236.22 g/mol

Ref: 3D-AMA54191