CAS 300571-94-2

4-[(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)amino]butanoate

Description:

4-[(2,3-Dihydro-1,4-benzodioxin-6-ylsulfonyl)amino]butanoate, identified by its CAS number 300571-94-2, is a chemical compound characterized by its unique structure that includes a butanoate moiety linked to a sulfonamide group derived from a benzodioxin. This compound features a sulfonyl group attached to an amino group, which contributes to its potential biological activity. The presence of the benzodioxin ring system suggests that it may exhibit interesting pharmacological properties, possibly related to its interactions with biological targets. The compound is likely to be soluble in polar solvents due to the presence of the sulfonamide and carboxylate functional groups. Its molecular structure may allow for various applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents a class of sulfonamide derivatives that may have significant implications in drug design and development.

Formula: C₁₂H₁₄NO₆S

InChI: InChI=1/C12H15NO6S/c14-12(15)2-1-5-13-20(16,17)9-3-4-10-11(8-9)19-7-6-18-10/h3-4,8,13H,1-2,5-7H2,(H,14,15)/p-1

SMILES: C(CC(=O)[O-])CNS(=O)(=O)c1ccc2c(c1)OCCO2

4-(2,3-Dihydro-benzo[1,4]dioxine-6-sulfonylamino)-butyric acid

CAS: 300571-94-2

Versatile small molecule scaffold

Formula: C₁₂H₁₅NO₆S

Purity: Min. 95%

Molecular weight: 301.32 g/mol

Ref: 3D-AMA57194