CAS 30062-49-8
:5-(Propylthio)-1,3,4-thiadiazol-2-amine
Description:
5-(Propylthio)-1,3,4-thiadiazol-2-amine is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and three carbon atoms, along with a propylthio group. This compound typically exhibits properties associated with thiadiazoles, such as potential biological activity and the ability to participate in various chemical reactions due to the presence of the amine functional group. The propylthio substituent can influence the compound's solubility, reactivity, and interaction with biological systems. Thiadiazoles are often studied for their pharmacological properties, including antimicrobial and antifungal activities. The compound's structure suggests it may be of interest in medicinal chemistry and agricultural applications, particularly as a potential agrochemical or pharmaceutical agent. As with many heterocycles, the electronic properties and steric effects of the substituents play a crucial role in determining the compound's overall behavior in chemical reactions and biological interactions.
Formula:C5H9N3S2
InChI:InChI=1S/C5H9N3S2/c1-2-3-9-5-8-7-4(6)10-5/h2-3H2,1H3,(H2,6,7)
InChI key:InChIKey=UWXTXBIBHSFVCG-UHFFFAOYSA-N
SMILES:S(CCC)C=1SC(N)=NN1
Synonyms:- 1,3,4-Thiadiazole, 2-amino-5-(propylthio)-
- 1,3,4-Thiadiazole,2-amino-5-(propylthio)- (7CI,8CI)
- 2-Amino-5-propylthio-1,2,4-thiadiazol
- 2-Amino-5-propylthio-1,3,4-thiadiazole
- 5-(Propylthio)-1,3,4-thiadiazol-2-amine
- 1,3,4-Thiadiazol-2-amine, 5-(propylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(Propylsulfanyl)-1,3,4-thiadiazol-2-amine
CAS:Formula:C5H9N3S2Color and Shape:SolidMolecular weight:175.2751
