CAS 300664-74-8

2-[(4-fluorophenyl)carbonyl]-1-benzofuran-5-carbaldehyde

Description:

2-[(4-Fluorophenyl)carbonyl]-1-benzofuran-5-carbaldehyde is an organic compound characterized by its complex structure, which includes a benzofuran moiety and a fluorophenyl group. This compound features a carbonyl group (C=O) attached to both the benzofuran and the phenyl ring, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the fluorine atom on the phenyl ring can enhance the compound's lipophilicity and influence its biological activity, making it of interest in drug design. The aldehyde functional group (–CHO) is also significant, as it can participate in various chemical reactions, including condensation and oxidation. This compound may exhibit unique physical properties such as solubility in organic solvents and specific melting or boiling points, which are influenced by its molecular structure. Overall, 2-[(4-fluorophenyl)carbonyl]-1-benzofuran-5-carbaldehyde is a valuable compound for research and development in the fields of chemistry and pharmaceuticals.

Formula: C₁₆H₉FO₃

InChI: InChI=1/C16H9FO3/c17-13-4-2-11(3-5-13)16(19)15-8-12-7-10(9-18)1-6-14(12)20-15/h1-9H

Synonyms:

• 2-(4-Fluorobenzoyl)-1-benzofuran-5-carbaldehyde
• 5-Benzofurancarboxaldehyde, 2-(4-fluorobenzoyl)-

2-(4-fluorobenzoyl)-1-benzofuran-5-carboxaldehyde

CAS: 300664-74-8

2-(4-fluorobenzoyl)-1-benzofuran-5-carboxaldehyde

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 268.24g/mol

Ref: 54-PC32114

2-(4-Fluoro-benzoyl)-benzofuran-5-carbaldehyde

CAS: 300664-74-8

Molecular weight: 268.2430114746094

Ref: 10-F038219