CAS 300664-77-1

2-[(4-methoxyphenyl)carbonyl]-1-benzofuran-5-carbaldehyde

Description:

2-[(4-Methoxyphenyl)carbonyl]-1-benzofuran-5-carbaldehyde is an organic compound characterized by its complex structure, which includes a benzofuran moiety and a methoxyphenyl group. This compound features a carbonyl group (aldehyde) and is known for its potential applications in medicinal chemistry and organic synthesis. The presence of the methoxy group enhances its solubility and may influence its biological activity. The benzofuran structure contributes to its aromatic properties, making it a candidate for various chemical reactions, including electrophilic substitutions and coupling reactions. Additionally, the compound may exhibit interesting photophysical properties due to its conjugated system, which can be explored in materials science and dye applications. Its specific reactivity and interactions can be influenced by the substituents on the aromatic rings, making it a versatile building block in the synthesis of more complex molecules. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity.

Formula: C₁₇H₁₂O₄

InChI: InChI=1/C17H12O4/c1-20-14-5-3-12(4-6-14)17(19)16-9-13-8-11(10-18)2-7-15(13)21-16/h2-10H,1H3

SMILES: COc1ccc(cc1)C(=O)c1cc2cc(ccc2o1)C=O

Synonyms:

• 2-(4-Methoxybenzoyl)-1-Benzofuran-5-Carbaldehyde
• 5-Benzofurancarboxaldehyde, 2-(4-Methoxybenzoyl)-
• 2-(4-Methoxybenzoyl)-1-benzofurane-5-carbaldehyde
• 2-(4-METHOXYBENZOYL)-1-BENZOFURAN-5-CARBOXALDEHYDE

2-(4-Methoxybenzoyl)-1-benzofuran-5-carboxaldehyde

CAS: 300664-77-1

2-(4-Methoxybenzoyl)-1-benzofuran-5-carboxaldehyde

Purity: ≥95%

Molecular weight: 280.27g/mol

Ref: 54-OR27629