CAS 300665-29-6

2-(chloromethyl)-5-naphthalen-2-yl-1,3,4-oxadiazole

Description:

2-(Chloromethyl)-5-naphthalen-2-yl-1,3,4-oxadiazole is a chemical compound characterized by its unique structure, which includes a naphthalene moiety and an oxadiazole ring. The presence of the chloromethyl group enhances its reactivity, making it a potential intermediate in organic synthesis. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its oxadiazole ring contributes to its potential applications in materials science, particularly in the development of fluorescent or luminescent materials, as well as in pharmaceuticals due to its biological activity. The compound may also display interesting electronic properties, making it suitable for use in electronic devices or sensors. Safety data should be consulted for handling, as the chloromethyl group can pose hazards. Overall, 2-(chloromethyl)-5-naphthalen-2-yl-1,3,4-oxadiazole represents a versatile building block in synthetic chemistry with potential applications across various fields.

Formula: C₁₃H₉ClN₂O

InChI: InChI=1/C13H9ClN2O/c14-8-12-15-16-13(17-12)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2

SMILES: c1ccc2cc(ccc2c1)c1nnc(CCl)o1

2-(chloromethyl)-5-(2-naphthyl)-1,3,4-oxadiazole

CAS: 300665-29-6

2-(chloromethyl)-5-(2-naphthyl)-1,3,4-oxadiazole

Purity: ≥95%

Molecular weight: 244.68g/mol

Ref: 54-OR27651