CAS 3008-31-9

2,2',2'',3,3',3'',4,4'',5,5',5'',6,6',6''-tetradecafluoro-1,1':4',1''-terphenyl

Description:

2,2',2'',3,3',3'',4,4'',5,5',5'',6,6',6''-tetradecafluoro-1,1':4',1''-terphenyl, commonly referred to as a fluorinated organic compound, is characterized by its unique structure comprising multiple aromatic rings and a high degree of fluorination. This compound features a terphenyl backbone, which consists of three phenyl groups linked by carbon-carbon bonds, with fluorine atoms substituting hydrogen atoms at various positions. The extensive fluorination imparts significant chemical stability, hydrophobicity, and lipophobicity, making it resistant to degradation and reactive processes. Additionally, the presence of fluorine enhances its thermal stability and lowers its surface energy, which can be beneficial in various applications, including as a non-stick coating or in electronic materials. The compound is typically colorless or pale yellow and may exhibit low volatility. Its unique properties make it of interest in fields such as materials science, electronics, and potentially in specialized applications where chemical inertness and thermal stability are required. However, handling and disposal must be approached with caution due to potential environmental and health impacts associated with fluorinated compounds.

Formula: C₁₈F₁₄

InChI: InChI=1/C18F14/c19-5-1(3-9(23)13(27)17(31)14(28)10(3)24)6(20)8(22)2(7(5)21)4-11(25)15(29)18(32)16(30)12(4)26

SMILES: c1(c2c(c(c(c(c2F)F)F)F)F)c(c(c(c2c(c(c(c(c2F)F)F)F)F)c(c1F)F)F)F

p-Perfluoroterphenyl

Controlled Product

CAS: 3008-31-9

Formula: C₁₈F₁₄

Color and Shape: Neat

Molecular weight: 482.17

Ref: TR-P286720

p-Perfluoroterphenyl

CAS: 3008-31-9

p-Perfluoroterphenyl is a potent inhibitor of kinases, which are enzymes that play a crucial role in the regulation of cell growth and division. This compound has been extensively studied in Chinese medicinal research for its anticancer properties. It has been shown to inhibit the growth of tumor cells and induce apoptosis, or programmed cell death, in cancer cells. Additionally, p-Perfluoroterphenyl has been found to be an effective inhibitor of protein kinases, which regulate many important cellular processes. This analog has also been detected in human urine samples, indicating its potential as a diagnostic tool for cancer detection and treatment. Overall, p-Perfluoroterphenyl is a promising new compound with potential applications in cancer therapy and diagnosis.

Formula: C₁₈F₁₄

Purity: Min. 95%

Molecular weight: 482.2 g/mol

Ref: 3D-DAA00831