CAS 3008-39-7
:1,2-Cycloheptanedione
Description:
1,2-Cycloheptanedione is a cyclic diketone characterized by its seven-membered carbon ring structure, featuring two carbonyl (C=O) groups located at the 1 and 2 positions of the ring. This compound is a colorless to pale yellow liquid with a distinctive odor and is known for its reactivity due to the presence of the carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. It has a relatively low boiling point and is soluble in organic solvents, making it useful in organic synthesis. The compound can serve as a building block in the synthesis of more complex molecules and is of interest in the field of organic chemistry for its potential applications in pharmaceuticals and agrochemicals. Additionally, 1,2-cycloheptanedione can undergo tautomerization, leading to the formation of enol forms, which can further participate in chemical reactions. Safety precautions should be taken when handling this substance, as it may pose health risks upon exposure.
Formula:C7H10O2
InChI:InChI=1S/C7H10O2/c8-6-4-2-1-3-5-7(6)9/h1-5H2
InChI key:InChIKey=SLOCIJOTBVAMAJ-UHFFFAOYSA-N
SMILES:O=C1C(=O)CCCCC1
Synonyms:- 1,2-Cycloheptanedione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,2-Cycloheptanedione
CAS:Controlled Product<p>Applications 1,2-Cycloheptanedione is a reagent in the synthesis of 3,3’-Polymethylene-2,2’-bibenzo[b]-1,10-phenanthrolines.<br>References Rahman, A. F. M., et al.: Heterocycles, 75, 871-877 (2008)<br></p>Formula:C7H10O2Color and Shape:NeatMolecular weight:126.15Cycloheptane-1,2-dione
CAS:<p>Cycloheptane-1,2-dione is an organic solvent that has a hydroxyl group and a methyl ethyl group. It is used as a reaction medium in the preparation of dioxime from ketones. Cycloheptane-1,2-dione is also used as an inhibitor in the kinetic study of reactions because it can be removed by physical methods or by adding a chlorine atom to form a compound with a nitro group. Cycloheptane-1,2-dione is also used in diagnosis tests for inhibition of compounds that are damaging to dry weight or for which radiation enhances their activity. These inhibitory compounds can be identified using cycloheptane-1,2-dione as the reagent. Cycloheptane-1,2-dione can be synthesized in large quantities and at low cost by reacting chlorine gas with dimethylcyclohexanone.</p>Formula:C7H10O2Purity:Min. 95%Molecular weight:126.15 g/mol


