CAS 300816-12-0

N-[2-Oxo-2-phenyl-1-(2-pyrimidinylamino)ethyl]benzamide

Description:

N-[2-Oxo-2-phenyl-1-(2-pyrimidinylamino)ethyl]benzamide, with the CAS number 300816-12-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzamide moiety and a pyrimidine ring. This compound typically exhibits properties associated with both amides and ketones, such as moderate solubility in organic solvents and potential interactions with biological targets due to its ability to form hydrogen bonds. The presence of the phenyl and pyrimidinyl groups suggests potential aromatic characteristics, which may contribute to its stability and reactivity. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and interactions would depend on further studies, including pharmacological evaluations and structure-activity relationship analyses. Overall, this compound represents a class of molecules that could be explored for various chemical and biological applications.

Formula: C₁₉H₁₆N₄O₂

InChI: InChI=1S/C19H16N4O2/c24-16(14-8-3-1-4-9-14)17(23-19-20-12-7-13-21-19)22-18(25)15-10-5-2-6-11-15/h1-13,17H,(H,22,25)(H,20,21,23)

InChI key: InChIKey=SQRPBDFYIVAQSB-UHFFFAOYSA-N

SMILES: C(C(=O)C1=CC=CC=C1)(NC(=O)C2=CC=CC=C2)NC=3N=CC=CN3

Synonyms:

• N-[2-Oxo-2-phenyl-1-(2-pyrimidinylamino)ethyl]benzamide
• ZINC00230567
• Benzamide, N-[2-oxo-2-phenyl-1-(2-pyrimidinylamino)ethyl]-

ZINC00230567

CAS: 300816-12-0

ZINC00230567 is an inhibitor of Lipocalin-2 (LCN2). It can reduce colony formation and cellular viability in SUM149 cells, demonstrating antitumor activity.

Formula: C₁₉H₁₆N₄O₂

Color and Shape: Solid

Molecular weight: 332.36

Ref: TM-T203441