CAS 30082-41-8

3-{[(4-chlorophenyl)sulfanyl]methyl}benzoate

Description:

3-{[(4-Chlorophenyl)sulfanyl]methyl}benzoate, with the CAS number 30082-41-8, is an organic compound characterized by its benzoate structure, which includes a benzoic acid derivative. The presence of a sulfanyl (thioether) group attached to a chlorophenyl moiety contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents, reflecting its hydrophobic characteristics due to the aromatic rings and the chlorinated phenyl group. The chlorophenyl substituent can influence the compound's reactivity and stability, often enhancing its lipophilicity. Additionally, the sulfanyl group may participate in various chemical reactions, such as nucleophilic substitutions or redox reactions. The compound's potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its biological activity and interaction with other chemical entities. Overall, 3-{[(4-chlorophenyl)sulfanyl]methyl}benzoate is a compound of interest for further research in synthetic chemistry and its applications in various fields.

Formula: C₁₄H₁₁ClO₂S

InChI: InChI=1/C14H11ClO2S/c15-12-4-6-13(7-5-12)18-9-10-2-1-3-11(8-10)14(16)17/h1-8H,9H2,(H,16,17)

SMILES: c1cc(cc(c1)C(=O)O)CSc1ccc(cc1)Cl

Synonyms:

• 3-{[(4-Chlorophenyl)Thio]Methyl}Benzoic Acid
• 3-{[(4-Chlorophenyl)Sulfanyl]Methyl}Benzoic Acid

3-{[(4-Chlorophenyl)sulfanyl]methyl}benzoic acid

CAS: 30082-41-8

Versatile small molecule scaffold

Formula: C₁₄H₁₁ClO₂S

Purity: Min. 95%

Molecular weight: 278.8 g/mol

Ref: 3D-FBA08241