CAS 300839-40-1

2-[4-methyl-6-(1-methylethoxy)pyrimidin-2-yl]phenol

Description:

2-[4-methyl-6-(1-methylethoxy)pyrimidin-2-yl]phenol, with the CAS number 300839-40-1, is an organic compound characterized by its complex structure, which includes a pyrimidine ring and a phenolic group. This substance typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for compounds containing both aromatic and heterocyclic moieties. The presence of the methyl and methylethoxy substituents contributes to its lipophilicity, potentially influencing its biological activity and interaction with other molecules. As a phenolic compound, it may exhibit antioxidant properties and could be of interest in pharmaceutical applications. The specific reactivity and stability of this compound can vary based on environmental conditions, such as pH and temperature. Additionally, its synthesis and handling require standard safety precautions typical for organic chemicals, including the use of personal protective equipment and proper waste disposal methods. Overall, this compound's unique structure suggests potential utility in various chemical and biological applications.

Formula: C₁₄H₁₆N₂O₂

InChI: InChI=1/C14H16N2O2/c1-9(2)18-13-8-10(3)15-14(16-13)11-6-4-5-7-12(11)17/h4-9,17H,1-3H3

SMILES: CC(C)Oc1cc(C)nc(c2ccccc2O)n1

Synonyms:

• 2-(4-Isopropoxy-6-methylpyrimidin-2-yl)phenol
• 2-(4-Isopropoxy-6-methyl-pyrimidin-2-yl)-phenol
• Phenol, 2-[4-methyl-6-(1-methylethoxy)-2-pyrimidinyl]-

2-(4-isopropoxy-6-methyl-2-pyrimidinyl)phenol

CAS: 300839-40-1

Formula: C₁₄H₁₆N₂O₂

Purity: 95.0%

Molecular weight: 244.294

Ref: 10-F313927