
CAS 300842-64-2
:N-(3-Bromo-4-methylphenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine
Description:
N-(3-Bromo-4-methylphenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine is a chemical compound characterized by its complex structure, which includes a phthalazine core, a brominated aromatic ring, and a pyridine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the amine and bromine substituents. The bromine atom can enhance the compound's reactivity and influence its electronic properties, while the pyridine ring may contribute to its solubility and interaction with biological targets. The presence of multiple functional groups suggests that this compound could participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Additionally, its structural features may allow for specific interactions with enzymes or receptors, potentially leading to therapeutic applications. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C21H17BrN4
InChI:InChI=1/C21H17BrN4/c1-14-6-7-16(13-19(14)22)24-21-18-5-3-2-4-17(18)20(25-26-21)12-15-8-10-23-11-9-15/h2-11,13H,12H2,1H3,(H,24,26)
SMILES:Cc1ccc(cc1Br)N=c1c2ccccc2c(Cc2ccncc2)n[nH]1
Synonyms:- Acc-789
- Zk-202650
- Nvp-Acc-789
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-(3-Bromo-4-methylphenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine
CAS:Formula:C21H17BrN4Purity:99%Color and Shape:SolidMolecular weight:405.2905NVP-ACC789
CAS:ACC-789 (NVP-ACC789 (ZK202650); ZK-202650) is an effective, specific and orally active inhibitor of the VEGF receptor tyrosine kinases.
Formula:C21H17BrN4Purity:99.44% - 99.63%Color and Shape:SolidMolecular weight:405.29NVP-ACC789
CAS:NVP-ACC789 is a protein kinase inhibitor that inhibits the activity of the vascular endothelial growth factor receptor (VEGFR). It has been shown to be effective against cancer-related genes and tumor cells in animal models. The drug is also being monitored for adverse effects in humans. The drug can be administered orally or intravenously. NVP-ACC789 has an effective dose of 100 mg per day and can be used as a single agent or combined with other drugs such as nitrosourea.
Formula:C21H17BrN4Purity:Min. 95%Molecular weight:405.29 g/molRef: 3D-AMA84264
Discontinued product



