CAS 30087-33-3
:α-Methyl-9-oxo-9H-xanthene-2-acetic acid
Description:
α-Methyl-9-oxo-9H-xanthene-2-acetic acid, with the CAS number 30087-33-3, is a chemical compound that belongs to the xanthene family, characterized by a fused ring structure containing both aromatic and carbonyl functionalities. This compound typically exhibits a yellow to orange color, which is common among xanthene derivatives due to their conjugated systems. It is soluble in organic solvents, such as ethanol and dimethyl sulfoxide, but may have limited solubility in water. The presence of the acetic acid moiety suggests that it can participate in acid-base reactions, potentially acting as a weak acid. Its structure allows for various chemical modifications, making it useful in synthetic organic chemistry and potentially in the development of fluorescent dyes or biological probes. Additionally, the compound may exhibit interesting photophysical properties, which can be exploited in applications such as imaging or sensing. As with many xanthene derivatives, it is essential to handle this compound with care, considering safety data and potential hazards associated with its use.
Formula:C16H12O4
InChI:InChI=1/C16H12O4/c1-9(16(18)19)10-6-7-14-12(8-10)15(17)11-4-2-3-5-13(11)20-14/h2-9H,1H3,(H,18,19)
InChI key:InChIKey=JUCCZCZDAPBGIV-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC=3C1=CC=CC3)=CC=C(C(C(O)=O)C)C2
Synonyms:- 9H-Xanthene-2-acetic acid, α-methyl-9-oxo-
- Xanthene-2-acetic acid, α-methyl-9-oxo-
- α-Methyl-9-oxo-9H-xanthene-2-acetic acid
- Y 5554
- 2-(9-Oxoxanthen-2-yl)propionic acid
- 2-(9-Oxo-9H-xanthen-2-yl)propanoic acid
- 2-(9-Oxoxanthen-2-yl)propionicAcid>
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(9-Oxoxanthen-2-yl)propionic Acid
CAS:Formula:C16H12O4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:268.27α-Methyl-9-oxo-9H-xanthene-2-acetic acid
CAS:Formula:C16H12O4Purity:98%Color and Shape:SolidMolecular weight:268.26412-(9-Oxoxanthen-2-yl)propionic acid
CAS:2-(9-Oxoxanthen-2-yl)propionic Acid is a polychromatic diluent that can be used in devices, coatings, and photoelectron microscopy. It has been reported to have antibacterial activity. This chemical has been shown to react with thiolates and silver ions to form reactive oxygen species that can kill bacteria. 2-(9-Oxoxanthen-2-yl)propionic Acid also dimerizes with anions such as chloride or fluoride under irradiation, leading to a change in the optical properties of the material.Formula:C16H12O4Purity:Min. 95%Molecular weight:268.27 g/mol




