CAS 30093-99-3: 4,4-Dimethyl-2-oxazoline

Description:4,4-Dimethyl-2-oxazoline is a heterocyclic organic compound characterized by its five-membered ring structure containing both nitrogen and oxygen atoms. It features two methyl groups attached to the carbon adjacent to the nitrogen, which contributes to its unique properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in water and various organic solvents, making it versatile for different applications. 4,4-Dimethyl-2-oxazoline is known for its use in polymer chemistry, particularly as a monomer in the synthesis of poly(oxazoline) polymers, which exhibit biocompatibility and are used in biomedical applications. Additionally, it can act as a ligand in coordination chemistry and has potential applications in the production of surfactants and emulsifiers. The compound is generally stable under standard conditions but should be handled with care due to its potential reactivity and the need for proper safety measures during use.

Formula:C₅H₉NO

InChI:InChI=1S/C5H9NO/c1-5(2)3-7-4-6-5/h4H,3H2,1-2H3

InChI key:InChIKey=KOAMXHRRVFDWRQ-UHFFFAOYSA-N

SMILES:N1=COCC1(C)C

Synonyms:
2-Oxazoline, 4,4-dimethyl-
4,4-Dimethyl-1,3-oxazoline
4,4-Dimethyl-4,5-Dihydro-1,3-Oxazole
4,4-Dimethyloxazoline
4,5-Dihydro-4,4-dimethyloxazole
Oxazole, 4,5-dihydro-4,4-dimethyl-
4,4-Dimethyl-2-oxazoline

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4,4-Dimethyl-2-oxazoline REF: 3B-D2742CAS: 30093-99-3	>97.0%(GC)(T)	87.00 €	Mon 07 Apr 25
4,4-Dimethyl-2-oxazoline, 98% REF: 02-A12670CAS: 30093-99-3	98%	To inquire	Tue 08 Apr 25
4,4-DIMETHYL-2-OXAZOLINE REF: IN-DA003KFSCAS: 30093-99-3	98%	30.00 €~493.00 €	Mon 14 Apr 25
4,4-Dimethyl-2-oxazoline, 98% REF: AC-35527CAS: 30093-99-3	98%	To inquire	Thu 17 Apr 25
4,4-Dimethyl-2-oxazoline REF: 10-F094824CAS: 30093-99-3	98.0%	To inquire	Thu 24 Apr 25