CAS 30095-47-7

2-bromo-1-(4-tert-butylphenyl)ethanone

Description:

2-bromo-1-(4-tert-butylphenyl)ethanone is an organic compound characterized by its structure, which includes a bromine atom and a ketone functional group. The presence of the tert-butyl group enhances its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a relatively high boiling point due to the presence of the bromine atom and the bulky tert-butyl group, which can influence its reactivity and stability. The compound is often used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Its reactivity can be attributed to the electrophilic nature of the carbonyl group, making it a suitable candidate for nucleophilic attack in various chemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled.

Formula: C₁₂H₁₅BrO

InChI: InChI=1/C12H15BrO/c1-12(2,3)10-6-4-9(5-7-10)11(14)8-13/h4-7H,8H2,1-3H3

SMILES: CC(C)(C)c1ccc(cc1)C(=O)CBr

Synonyms:

• 2-Bromo-1-(4-tert-butyl-phenyl)-ethanone

2-BROMO-1-(4-TERT-BUTYL-PHENYL)-ETHANONE

CAS: 30095-47-7

Formula: C₁₂H₁₅BrO

Purity: 97%

Molecular weight: 255.1509

Ref: IN-DA00C1UI

2-Bromo-1-(4-tert-butyl-phenyl)-ethanone

CAS: 30095-47-7

Purity: 98%

Molecular weight: 255.1549988

Ref: 10-F639137

2-Bromo-4'-tert-butylacetophenone

Controlled Product

CAS: 30095-47-7

Formula: C₁₂H₁₅BrO

Color and Shape: Neat

Molecular weight: 255.151

Ref: TR-B681990