CAS 30100-83-5
:1-pentofuranosyldihydropyrimidine-2,4(1H,3H)-dione
Description:
1-Pentofuranosyldihydropyrimidine-2,4(1H,3H)-dione, identified by its CAS number 30100-83-5, is a chemical compound that features a pyrimidine ring, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound is characterized by the presence of a furanosyl group, indicating that it has a five-membered sugar-like structure attached to the pyrimidine moiety. The presence of two carbonyl groups in the 2 and 4 positions of the pyrimidine ring contributes to its diketone nature, which can influence its reactivity and potential interactions with biological systems. The compound may exhibit properties typical of both nucleosides and nucleotides, potentially participating in biochemical pathways or serving as a precursor in synthetic chemistry. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a biochemical probe.
Formula:C9H14N2O6
InChI:InChI=1/C9H14N2O6/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h4,6-8,12,14-15H,1-3H2,(H,10,13,16)/t4-,6-,7-,8-/m0/s1
SMILES:C1CN([C@@H]2[C@H]([C@H]([C@H](CO)O2)O)O)C(=O)N=C1O
Synonyms:- 5627-05-4
- 1-β-L-ribofuranosyldihydropyrimidine-2,4(1H,3H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5,6-Dihydro-ara-uridine
CAS:Nucleoside Derivatives - 5,6-Dihydrouridine; Arabino-nucleosideFormula:C9H14N2O6Color and Shape:SolidMolecular weight:246.22Ref: TM-TNU0307
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire5,6-Dihydro-ara-uridine
CAS:5,6-Dihydro-ara-uridine is a fine chemical that belongs to the group of compounds known as uridine analogues. It can be used as a versatile building block in the synthesis of other compounds and has been shown to be an effective intermediate in the synthesis of various research chemicals. 5,6-Dihydro-ara-uridine is also commonly used as a reaction component and reagent in the polymerization process. This compound is high quality and has CAS No. 30100-83-5.
Formula:C9H14N2O6Purity:Min. 95%Color and Shape:White PowderMolecular weight:246.22 g/mol

