CAS 30113-83-8

7-hydroxy-4-oxo-4H-chromene-2-carboxylic acid

Description:

7-Hydroxy-4-oxo-4H-chromene-2-carboxylic acid, also known as coumarin-3-carboxylic acid, is a chemical compound belonging to the coumarin family, characterized by its chromene structure. This compound features a hydroxyl group and a carboxylic acid functional group, contributing to its solubility in polar solvents. It typically exhibits a yellowish crystalline appearance and has a melting point that varies depending on purity and environmental conditions. The presence of the hydroxyl group enhances its potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as anti-inflammatory and antioxidant properties. Additionally, it may serve as a precursor for the synthesis of other chemical derivatives. As with many organic compounds, safety precautions should be taken when handling it, as it may pose risks if ingested or inhaled.

Formula: C₁₀H₆O₅

InChI: InChI=1/C10H6O5/c11-5-1-2-6-7(12)4-9(10(13)14)15-8(6)3-5/h1-4,11H,(H,13,14)

SMILES: c1cc2c(=O)cc(C(=O)O)oc2cc1O

Synonyms:

• 4H-1-benzopyran-2-carboxylic acid, 7-hydroxy-4-oxo-
• 7-Hydroxy-4-oxo-4H-chromene-2-carboxylic acid

7-Hydroxy-4-oxo-4H-chromene-2-carboxylic acid

CAS: 30113-83-8

7-Hydroxy-4-oxo-4H-chromene-2-carboxylic acid

Purity: 95%

Molecular weight: 206.15g/mol

Ref: 54-OR1044005

7-Hydroxy-4-oxo-4H-chromene-2-carboxylic acid

CAS: 30113-83-8

7-Hydroxy-4-oxo-4H-chromene-2-carboxylic acid is a molecule that is found in the human body. It has been shown to have cationic polymer activity and to inhibit the growth of bacteria by binding to the hydroxyl group of DNA. 7-Hydroxy-4-oxo-4H-chromene-2-carboxylic acid has potent inhibitory activity against Gram positive and Gram negative bacteria, including Mycobacterium tuberculosis and Staphylococcus aureus. This compound can be used as an antibiotic for bacterial infections due to its ability to bind with high concentrations of the hydroxyl group on DNA.

Formula: C₁₀H₆O₅

Purity: Min. 95%

Molecular weight: 206.15 g/mol

Ref: 3D-FBA11383