CAS 301305-73-7: 2-[(3,4-dimethoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Description:2-[(3,4-Dimethoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide, with the CAS number 301305-73-7, is a synthetic organic compound characterized by its complex structure, which includes a benzothiophene core fused with a carboxamide and a dimethoxybenzoyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the dimethoxybenzoyl moiety may enhance its pharmacological properties, while the tetrahydrobenzothiophene structure contributes to its overall stability and reactivity. The compound may also display specific interactions with biological targets, which could be explored for therapeutic applications. Its synthesis involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its identity and purity. Overall, this compound represents a class of molecules that could have significant implications in drug development and research.
Formula:C18H20N2O4S
InChI:InChI=1/C18H20N2O4S/c1-23-12-8-7-10(9-13(12)24-2)17(22)20-18-15(16(19)21)11-5-3-4-6-14(11)25-18/h7-9H,3-6H2,1-2H3,(H2,19,21)(H,20,22)
- Synonyms:
- Benzo[b]thiophene-3-carboxamide, 2-[(3,4-dimethoxybenzoyl)amino]-4,5,6,7-tetrahydro-
- Tcs-359