CAS 30131-16-9
:4-(4-Phenylbutoxy)benzoic acid
Description:
4-(4-Phenylbutoxy)benzoic acid, with the CAS number 30131-16-9, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which includes a carboxylic acid (-COOH) group, contributing to its acidic properties. The compound also contains a phenylbutoxy group, which consists of a phenyl ring attached to a butoxy chain, enhancing its hydrophobic characteristics. This structure can influence its solubility, making it more soluble in organic solvents than in water. The presence of both hydrophilic (carboxylic acid) and hydrophobic (phenylbutoxy) components suggests potential applications in various fields, including pharmaceuticals and materials science, where it may serve as an intermediate or a functional additive. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Overall, 4-(4-Phenylbutoxy)benzoic acid exemplifies the complexity and versatility of organic compounds in chemical research and application.
Formula:C17H18O3
InChI:InChI=1/C17H18O3/c1-2-3-12-20-16-10-8-14(9-11-16)13-4-6-15(7-5-13)17(18)19/h4-11H,2-3,12H2,1H3,(H,18,19)
SMILES:CCCCOc1ccc(cc1)c1ccc(cc1)C(=O)O
Synonyms:- 4-(4-Phenyl-butoxy)-benzoic acid
- P-Phenylbutoxybenzoic acid
- 4'-Butoxybiphenyl-4-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(4-Phenylbutoxy)benzoic Acid
CAS:Formula:C17H18O3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:270.334-(4-Phenylbutoxy)benzoic Acid
CAS:Formula:C17H18O3Purity:97%Color and Shape:SolidMolecular weight:270.32304-(4-Phenylbutoxy)benzoic acid
CAS:4-(4-Phenylbutoxy)benzoic acidPurity:99%Molecular weight:270.328g/mol4-(4-Phenylbutoxy)benzoic Acid
CAS:Controlled ProductApplications 4-(4-PHENYLBUTOXY)BENZOIC ACID (cas# 30131-16-9) is a useful research chemical.
Formula:C17H18O3Color and Shape:NeatMolecular weight:270.324-(4-Phenylbutoxy)-benzoic acid
CAS:Formula:C17H18O3Purity:98%Color and Shape:SolidMolecular weight:270.3284-(4-Phenylbutoxy)benzoic acid
CAS:4-(4-Phenylbutoxy)benzoic acid is an organic compound that is produced by the reaction of 4-hydroxybenzoic acid with a Grignard reagent. The 4-hydroxybenzoic acid reacts with magnesium to form magnesium chloride and p-hydroxybenzoic acid, which then reacts with a Grignard reagent to form the desired product. This compound has been used in wastewater treatment and as an intermediate in the synthesis of dyes, perfumes, and pharmaceuticals. 4-(4-Phenylbutoxy)benzoic acid has also been used as a starting material for synthesizing other compounds such as chlorobenzene and p-hydroxybenzoic acid.
Formula:C17H18O3Purity:Min. 95%Molecular weight:270.32 g/mol





