CAS 30132-23-1

ethyl 3-bromo-2-oxocyclohexanecarboxylate

Description:

Ethyl 3-bromo-2-oxocyclohexanecarboxylate is an organic compound characterized by its unique structure, which includes a cyclohexane ring, a bromine atom, and an ester functional group. This compound features a ketone group (2-oxo) adjacent to the carboxylate moiety, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it useful in nucleophilic substitution reactions. Ethyl 3-bromo-2-oxocyclohexanecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which facilitates its use in various chemical reactions. The compound may exhibit moderate toxicity, and appropriate safety measures should be taken when handling it. Its unique structural features make it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals, as well as in the development of novel materials.

Formula: C₉H₁₃BrO₃

InChI: InChI=1S/C9H13BrO3/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h6-7H,2-5H2,1H3

InChI key: InChIKey=VKCMWLOBUILIOQ-UHFFFAOYSA-N

SMILES: CCOC(=O)C1CCCC(C1=O)Br

Cyclohexanecarboxylicacid, 3-bromo-2-oxo-, ethyl ester

CAS: 30132-23-1

Formula: C₉H₁₃BrO₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 249.1017

Ref: IN-DA007JHP

Ethyl 3-bromo-2-oxocyclohexanecarboxylate

CAS: 30132-23-1

Ethyl 3-bromo-2-oxocyclohexanecarboxylate

Purity: 95%

Molecular weight: 249.10g/mol

Ref: 54-OR92998

Ethyl 3-bromo-2-oxocyclohexanecarboxylate

CAS: 30132-23-1

Purity: 95%

Molecular weight: 249.1040039

Ref: 10-F788478

Ethyl 3-bromo-2-oxocyclohexanecarboxylate

CAS: 30132-23-1

3-Bromo-2-oxocyclohexanecarboxylate is a diterpene alkaloid that has been prepared by the Friedel-Crafts reaction of ethyl bromoacetate and cyclohexane. The product is an intramolecular arylation, which means that the two carbons in the ring are bonded to each other. This type of reaction usually produces a group specific functional group, such as an acid chloride or ester, but in this case it produces an alcohol. 3-Bromo-2-oxocyclohexanecarboxylate is used as a precursor for silver salts which are used to make photographic film.

Formula: C₉H₁₃BrO₃

Purity: Min. 95%

Molecular weight: 249.1 g/mol

Ref: 3D-FBA13223