CAS 301321-97-1

2-amino-N-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide

Description:

2-amino-N-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide is a chemical compound characterized by its unique bicyclic structure, which incorporates a thiophene ring fused to a cycloheptane framework. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the N-methyl group suggests that it may exhibit specific steric and electronic properties, influencing its interactions in biological systems. The tetrahydro configuration indicates that the compound is saturated, which may enhance its stability and solubility in various solvents. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its CAS number, 301321-97-1, allows for easy identification and reference in chemical databases. Overall, the characteristics of this compound suggest potential applications in drug discovery and development, although specific biological activities would require further investigation.

Formula: C₁₁H₁₆N₂OS

InChI: InChI=1/C11H16N2OS/c1-13-11(14)9-7-5-3-2-4-6-8(7)15-10(9)12/h2-6,12H2,1H3,(H,13,14)

SMILES: CN=C(c1c2CCCCCc2sc1N)O

Synonyms:

• 4H-cyclohepta[b]thiophene-3-carboxamide, 2-amino-5,6,7,8-tetrahydro-N-methyl-

2-amino-N-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide

CAS: 301321-97-1

Formula: C₁₁H₁₆N₂OS

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 224.32

Ref: 10-F314426