CAS 301321-98-2

2-amino-N-ethyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide

Description:

2-amino-N-ethyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide is a chemical compound characterized by its unique bicyclic structure, which includes a thiophene ring fused to a cycloheptane framework. This compound features an amino group and an ethyl substituent, contributing to its potential biological activity. The presence of the carboxamide functional group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. The tetrahydro configuration indicates that the compound is saturated, which can affect its stability and interaction with biological targets. Its specific stereochemistry and functional groups may impart unique pharmacological properties, making it of interest in medicinal chemistry. The compound's CAS number, 301321-98-2, allows for precise identification in chemical databases, facilitating research and development in various applications, including drug discovery and development. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with potential therapeutic uses.

Formula: C₁₂H₁₈N₂OS

InChI: InChI=1/C12H18N2OS/c1-2-14-12(15)10-8-6-4-3-5-7-9(8)16-11(10)13/h2-7,13H2,1H3,(H,14,15)

SMILES: CCN=C(c1c2CCCCCc2sc1N)O

Synonyms:

• 4H-cyclohepta[b]thiophene-3-carboxamide, 2-amino-N-ethyl-5,6,7,8-tetrahydro-

2-Amino-N-ethyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide

CAS: 301321-98-2

Formula: C₁₂H₁₈N₂OS

Molecular weight: 238.3491

Ref: IN-DA00C1UT

2-amino-N-ethyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide

CAS: 301321-98-2

Formula: C₁₂H₁₈N₂OS

Purity: 95.0%

Molecular weight: 238.35

Ref: 10-F314431