CAS 30134-98-6

(cis-4-Aminocyclohexyl)methanol

Description:

(cis-4-Aminocyclohexyl)methanol, with the CAS number 30134-98-6, is an organic compound characterized by its cyclohexane structure with an amino group and a hydroxymethyl group attached. This compound features a cis configuration, indicating that the amino group and the hydroxymethyl group are on the same side of the cyclohexane ring, which can influence its physical and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of both amino and hydroxyl functional groups suggests that it may exhibit hydrogen bonding capabilities, affecting its solubility in polar solvents. Additionally, (cis-4-Aminocyclohexyl)methanol may have applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. Its reactivity can be attributed to the functional groups present, allowing for various chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₁₅NO

InChI: InChI=1/C7H15NO/c8-7-3-1-6(5-9)2-4-7/h6-7,9H,1-5,8H2/t6-,7+

Synonyms:

• cyclohexanemethanol, 4-amino-, cis-

Cyclohexanemethanol, 4-amino-, cis-

CAS: 30134-98-6

Versatile small molecule scaffold

Formula: C₇H₁₅NO

Purity: Min. 95%

Molecular weight: 129.2 g/mol

Ref: 3D-FBA13498