CAS 30148-18-6

(4-Chlorophenyl)(1-methyl-1H-imidazol-2-yl)methanone

Description:

(4-Chlorophenyl)(1-methyl-1H-imidazol-2-yl)methanone, with the CAS number 30148-18-6, is a chemical compound characterized by its unique structure, which includes a chlorophenyl group and an imidazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the imidazole ring, which is known for its role in various biochemical processes. The chlorophenyl group may enhance lipophilicity, influencing the compound's solubility and interaction with biological targets. Additionally, the presence of the carbonyl functional group (ketone) contributes to its reactivity, allowing for potential participation in various chemical reactions, such as nucleophilic attacks. The compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of pharmaceuticals, due to its structural features that could interact with specific biological pathways. Overall, its characteristics suggest a compound with potential applications in research and industry, particularly in the fields of drug discovery and development.

Formula: C₁₁H₉ClN₂O

InChI: InChI=1S/C11H9ClN2O/c1-14-7-6-13-11(14)10(15)8-2-4-9(12)5-3-8/h2-7H,1H3

InChI key: InChIKey=SDDUQCWOAVSVHV-UHFFFAOYSA-N

SMILES: C(=O)(C=1N(C)C=CN1)C2=CC=C(Cl)C=C2

Synonyms:

• Methanone, (4-chlorophenyl)(1-methyl-1H-imidazol-2-yl)-
• 2-(4-Chlorobenzoyl)-1-methyl-1H-imidazole
• (4-Chlorophenyl)(1-methyl-1H-imidazol-2-yl)methanone
• (4-Chlorophenyl)-(1-methylimidazol-2-yl)methanone
• Ketone, p-chlorophenyl 1-methylimidazol-2-yl

2-(4-Chlorobenzoyl)-1-methyl-1H-imidazole

Controlled Product

CAS: 30148-18-6

Versatile small molecule scaffold

Formula: C₁₁H₉ClN₂O

Purity: Min. 95%

Molecular weight: 220.65 g/mol

Ref: 3D-FBA14818