CAS 30148-26-6

(2-chlorophenyl)(1-methyl-1H-imidazol-2-yl)methanone

Description:

The chemical substance known as (2-chlorophenyl)(1-methyl-1H-imidazol-2-yl)methanone, with the CAS number 30148-26-6, is characterized by its unique molecular structure, which includes a chlorophenyl group and an imidazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the imidazole ring, which is often found in various pharmaceuticals. The chlorophenyl group can influence the compound's lipophilicity and reactivity, making it suitable for interactions with biological targets. Additionally, the presence of the carbonyl group (ketone) contributes to its reactivity, allowing for potential participation in various chemical reactions, such as nucleophilic attacks. The compound may also exhibit specific solubility characteristics, depending on the solvent used, and could be analyzed using techniques such as NMR, IR spectroscopy, or mass spectrometry for structural confirmation and purity assessment. Overall, this compound's unique features make it of interest in medicinal chemistry and related fields.

Formula: C₁₁H₉ClN₂O

InChI: InChI=1/C11H9ClN2O/c1-14-7-6-13-11(14)10(15)8-4-2-3-5-9(8)12/h2-7H,1H3

SMILES: Cn1ccnc1C(=O)c1ccccc1Cl

Synonyms:

• (2-Chloro-phenyl)-(1-methyl-1H-imidazol-2-yl)-methanone
• 2-(2-Chlorobenzoyl)-1-methyl-1H-imidazole
• 30148-26-6
• T5N Cnj A1 Bvr Bg [Wln]
• (2-Chlorophenyl)(1-methyl-1H-imidazol-2-yl)methanone

2-(2-Chlorobenzoyl)-1-methyl-1H-imidazole

Controlled Product

CAS: 30148-26-6

Versatile small molecule scaffold

Formula: C₁₁H₉ClN₂O

Purity: Min. 95%

Molecular weight: 220.65 g/mol

Ref: 3D-FBA14826