CAS 30161-95-6

5-amino-2-chloro[1,3]thiazolo[4,5-d]pyrimidin-7(6H)-one

Description:

5-amino-2-chloro[1,3]thiazolo[4,5-d]pyrimidin-7(6H)-one is a heterocyclic compound characterized by its unique structural features, which include a thiazole ring fused to a pyrimidine system. This compound contains an amino group and a chlorine atom, contributing to its reactivity and potential biological activity. The thiazole and pyrimidine moieties are known for their roles in various pharmacological applications, including antimicrobial and anticancer activities. The presence of the amino group enhances its solubility in polar solvents, while the chlorine atom can influence its lipophilicity and interaction with biological targets. The compound's molecular structure allows for potential hydrogen bonding and coordination with metal ions, making it of interest in medicinal chemistry and drug design. Additionally, its CAS number, 30161-95-6, serves as a unique identifier for regulatory and research purposes. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry, with implications for both synthetic and applied chemistry fields.

Formula: C₅H₃ClN₄OS

InChI: InChI=1/C5H3ClN4OS/c6-4-8-2-1(12-4)3(11)10-5(7)9-2/h(H3,7,9,10,11)

SMILES: c12c(nc(Cl)s2)[nH]c(=N)nc1O

5-Amino-2-chloro-2,3-dihydrothiazolo[4,5-d]pyrimidine-7-(6H)-one

Controlled Product

CAS: 30161-95-6

Applications 5-Amino-2-chloro-2,3-dihydrothiazolo[4,5-d]pyrimidine-7-(6H)-one (cas# 30161-95-6) is a compound useful in organic synthesis.
References Nagahara, K., et al.: J. Med. Chem., 33, 407 (1990),

Formula: C₅H₅ClN₄OS

Color and Shape: Neat

Molecular weight: 204.64

Ref: TR-A603438