CAS 30163-20-3
:3-Bromophenylalanine
Description:
3-Bromophenylalanine is an amino acid derivative characterized by the presence of a bromine atom attached to the phenyl ring at the meta position relative to the amino group. Its molecular structure includes both an amino group (-NH2) and a carboxylic acid group (-COOH), typical of amino acids, which allows it to participate in protein synthesis and biochemical processes. This compound is often used in biochemical research and studies involving protein engineering due to its ability to incorporate halogenated phenylalanine into proteins, potentially altering their properties and functions. 3-Bromophenylalanine is typically a white to off-white solid and is soluble in polar solvents. Its unique properties make it valuable in the synthesis of various pharmaceuticals and in the study of protein-ligand interactions. Safety precautions should be taken when handling this compound, as with many halogenated organic substances, due to potential toxicity and environmental concerns.
Formula:C9H10BrNO2
InChI:InChI=1/C9H10BrNO2/c10-7-3-1-2-6(4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m1/s1
SMILES:c1cc(cc(c1)Br)C[C@H](C(=O)O)N
Synonyms:- 2-Amino-3-(3-bromophenyl)propanoic acid
- 3-Bromo-DL-phenylalanine
- 2-Amino-3-(3-Bromo-Phenyl)-Propionic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-amino-3-(3-bromophenyl)propanoic acid
CAS:Formula:C9H10BrNO2Purity:97%Color and Shape:SolidMolecular weight:244.08522-Amino-3-(3-bromophenyl)propanoic acid
CAS:Formula:C9H10BrNO2Purity:95%Color and Shape:SolidMolecular weight:244.088DL-3-Bromophenylalanine
CAS:Controlled ProductApplications DL-3-Bromophenylalanine is used in the synthetic preparation of hydroxyethylene sulfones as scaffolds for design, synthesis, and structural characterization of aspartic proteinase inhibitors.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Specker, E.; et al.: J. Med. Chem, 48, 6607 (2005)Formula:C9H10BrNO2Color and Shape:NeatMolecular weight:244.09



