
CAS 301646-60-6
:N-[6-[2-(1,1-Dimethylethoxy)ethoxy]-5-(2-methoxyphenoxy)[2,2′-bipyrimidin]-4-yl]-4-(1,1-dimethylethyl)benzenesulfonamide
Description:
N-[6-[2-(1,1-Dimethylethoxy)ethoxy]-5-(2-methoxyphenoxy)[2,2′-bipyrimidin]-4-yl]-4-(1,1-dimethylethyl)benzenesulfonamide, with CAS number 301646-60-6, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as sulfonamide, ether, and aromatic rings. This compound is typically used in pharmaceutical research and development, particularly in the context of drug design due to its potential biological activity. The presence of the bipyrimidine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its solubility and stability can be influenced by the bulky dimethylethyl groups, which may enhance lipophilicity and affect pharmacokinetic properties. Additionally, the methoxyphenoxy group may contribute to its binding affinity and selectivity towards specific receptors or enzymes. Overall, this compound exemplifies the intricate design often employed in the development of targeted therapeutics.
Formula:C31H37N5O6S
InChI:InChI=1S/C31H37N5O6S/c1-30(2,3)21-13-15-22(16-14-21)43(37,38)36-26-25(42-24-12-9-8-11-23(24)39-7)29(40-19-20-41-31(4,5)6)35-28(34-26)27-32-17-10-18-33-27/h8-18H,19-20H2,1-7H3,(H,34,35,36)
InChI key:InChIKey=CIVGGGJJFBXIJY-UHFFFAOYSA-N
SMILES:O(C=1C(NS(=O)(=O)C2=CC=C(C(C)(C)C)C=C2)=NC(=NC1OCCOC(C)(C)C)C=3N=CC=CN3)C4=C(OC)C=CC=C4
Synonyms:- N-[6-[2-(1,1-Dimethylethoxy)ethoxy]-5-(2-methoxyphenoxy)[2,2′-bipyrimidin]-4-yl]-4-(1,1-dimethylethyl)benzenesulfonamide
- N-[6-(2-tert-Butoxyethoxy)-5-(2-methoxyphenoxy)-[2,2′]bipyrimidinyl-4-yl]-4-tert-butylbenzenesulfonamide
- Benzenesulfonamide, N-[6-[2-(1,1-dimethylethoxy)ethoxy]-5-(2-methoxyphenoxy)[2,2′-bipyrimidin]-4-yl]-4-(1,1-dimethylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
