CymitQuimica logo

CAS 301673-14-3

:

N-Boc-4-iodopiperidine

Description:
N-Boc-4-iodopiperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The "N-Boc" designation indicates that the nitrogen atom in the piperidine is protected by a tert-butyloxycarbonyl (Boc) group, a common protecting group in organic synthesis that enhances the stability and reactivity of the amine. The presence of the iodine atom at the 4-position of the piperidine ring introduces a halogen substituent, which can influence the compound's reactivity and potential applications in synthesis. N-Boc-4-iodopiperidine is typically used in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals and biologically active compounds. Its properties include moderate solubility in organic solvents and stability under standard laboratory conditions. The compound's structure allows for further functionalization, making it a versatile intermediate in the synthesis of various chemical entities. As with many halogenated compounds, care should be taken regarding its handling and disposal due to potential environmental and health impacts.
Formula:C10H18INO2
InChI:InChI=1/C10H18INO2/c1-10(2,3)14-9(13)12-6-4-8(11)5-7-12/h8H,4-7H2,1-3H3
InChI key:YFWQFKUQVJNPKP-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)I
Synonyms:
  • 1-(tert-Butoxycarbonyl)-4-iodopiperidine
  • 4-Iodopiperidine-1-carboxylic acid tert-butyl ester
  • Tert-Butyl 4-Iodopiperidine-1-Carboxylate
  • 4-Iodo-piperidine-1-carboxylic acid tert-butyl ester
Found 5 products.