CymitQuimica logo

CAS 301847-46-1

:

5-Amino-4-(3-methoxyphenyl)-2-(methylthio)thieno[2,3-d]pyrimidine-6-carboxylic acid

Description:
5-Amino-4-(3-methoxyphenyl)-2-(methylthio)thieno[2,3-d]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a thieno[2,3-d]pyrimidine core. This compound features an amino group and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. The presence of a methoxyphenyl group enhances its lipophilicity and may influence its interaction with biological targets. The methylthio substituent can affect the compound's electronic properties and reactivity. Typically, compounds of this nature are investigated for their pharmacological properties, including potential anti-cancer or anti-inflammatory activities. The molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological activity. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry and drug development.
Formula:C15H13N3O3S2
InChI:InChI=1S/C15H13N3O3S2/c1-21-8-5-3-4-7(6-8)11-9-10(16)12(14(19)20)23-13(9)18-15(17-11)22-2/h3-6H,16H2,1-2H3,(H,19,20)
InChI key:InChIKey=ZEHJCPMBJCCTJJ-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=C(SC)N=C2SC1C(O)=O)C3=CC(OC)=CC=C3
Synonyms:
  • Thieno[2,3-d]pyrimidine-6-carboxylic acid, 5-amino-4-(3-methoxyphenyl)-2-(methylthio)-
  • 5-Amino-4-(3-methoxyphenyl)-2-(methylthio)thieno[2,3-d]pyrimidine-6-carboxylic acid
Found 3 products.