CAS 3019-18-9

2-(ethylsulfanyl)-6-methylpyrimidin-4(1H)-one

Description:

2-(Ethylsulfanyl)-6-methylpyrimidin-4(1H)-one, with the CAS number 3019-18-9, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with an ethylsulfanyl group and a methyl group. The presence of the ethylsulfanyl group introduces a sulfur atom into the structure, which can influence the compound's reactivity and solubility. The methyl group at the 6-position contributes to the compound's overall hydrophobic character. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the nitrogen atoms in the pyrimidine ring. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidine derivatives are known for their biological activity. Additionally, the compound's structure may allow for various chemical modifications, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₇H₁₀N₂OS

InChI: InChI=1/C7H10N2OS/c1-3-11-7-8-5(2)4-6(10)9-7/h4H,3H2,1-2H3,(H,8,9,10)

SMILES: CCSc1nc(C)cc(n1)O

Synonyms:

• 2-(Ethylsulfanyl)-6-methylpyrimidin-4-ol
• 4(1H)-pyrimidinone, 2-(ethylthio)-6-methyl-
• 4-Pyrimidinol, 2-(Ethylthio)-6-Methyl-

2-Ethylsulfanyl-6-methyl-pyrimidin-4-ol

CAS: 3019-18-9

2-Ethylsulfanyl-6-methyl-pyrimidin-4-ol is a nitrogen heterocycle that can be used as a research chemical. It has been shown to have tumor necrosis factor activity and 6-methyluracil, which is an adamantyl substituent. This compound may also be an activator of hydrocarbon exocyclic radicals.

Formula: C₇H₁₀N₂OS

Purity: Min. 95%

Molecular weight: 170.23 g/mol

Ref: 3D-DAA01918