CAS 302-25-0
:Prednisolone phosphate
Description:
Prednisolone phosphate is a synthetic glucocorticoid and a derivative of prednisolone, primarily used for its anti-inflammatory and immunosuppressive properties. It is characterized by its phosphate ester form, which enhances its solubility and bioavailability compared to its parent compound. Prednisolone phosphate is typically administered in the form of its sodium salt, prednisolone sodium phosphate, which is often used in injectable formulations. The compound exhibits a range of pharmacological effects, including the modulation of immune responses and the reduction of inflammation, making it useful in treating conditions such as allergies, asthma, and autoimmune disorders. Its mechanism of action involves binding to glucocorticoid receptors, leading to the regulation of gene expression and subsequent physiological effects. Prednisolone phosphate is generally well-tolerated, but like other corticosteroids, it may have side effects, particularly with long-term use, including potential impacts on metabolism, immune function, and bone health. As with any medication, its use should be guided by a healthcare professional, considering the specific clinical context and patient needs.
Formula:C21H29O8P
InChI:InChI=1S/C21H29O8P/c1-19-7-5-13(22)9-12(19)3-4-14-15-6-8-21(25,17(24)11-29-30(26,27)28)20(15,2)10-16(23)18(14)19/h5,7,9,14-16,18,23,25H,3-4,6,8,10-11H2,1-2H3,(H2,26,27,28)/t14-,15-,16-,18+,19-,20-,21-/m0/s1
InChI key:InChIKey=JDOZJEUDSLGTLU-VWUMJDOOSA-N
SMILES:C[C@@]12[C@]([C@]3([C@]([C@@H](O)C1)([C@]4(C)C(CC3)=CC(=O)C=C4)[H])[H])(CC[C@@]2(C(COP(=O)(O)O)=O)O)[H]
Synonyms:- (11β)-11,17-Dihydroxy-21-(phosphonooxy)pregna-1,4-diene-3,20-dione
- 11beta,17,21-Trihydroxypregna-1,4-diene-3,20-dione 21-(dihydrogen phosphate)
- Prednisolone 21-(dihydrogen phosphate)
- Prednisolone 21-monophosphate
- Prednisolone 21-phosphate
- Prednisolone phosphate
- Predonine-21-phosphate
- Pregna-1,4-diene-3,20-dione, 11,17-dihydroxy-21-(phosphonooxy)-, (11β)-
- Pregna-1,4-diene-3,20-dione, 11β,17,21-trihydroxy-, 21-(dihydrogen phosphate)
- Unii-752Sy38R6C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
11,17-dihydroxy-21-(phosphonooxy)-Pregna-1,4-diene-3,20-dione
CAS:Controlled ProductApplications 11,17-dihydroxy-21-(phosphonooxy)-Pregna-1,4-diene-3,20-dione is a steroid.
Formula:C21H29O8PColor and Shape:NeatMolecular weight:440.424

