CAS 302-72-7: Alanine
Description:Alanine is a non-essential amino acid that plays a crucial role in protein synthesis and metabolism. It is classified as an aliphatic amino acid due to its side chain, which is a simple methyl group, making it hydrophobic. Alanine exists in two enantiomeric forms: L-alanine, which is the form incorporated into proteins, and D-alanine, which is less common and found in some bacterial cell walls. The molecular formula of alanine is C3H7NO2, and it features an amino group (-NH2), a carboxyl group (-COOH), and a side chain that distinguishes it from other amino acids. Alanine is soluble in water and has a neutral pH in its zwitterionic form, which is predominant in physiological conditions. It is involved in various metabolic pathways, including gluconeogenesis and the alanine cycle, which helps in the transport of nitrogen and carbon between tissues. Additionally, alanine is important for energy production and serves as a precursor for the synthesis of other biomolecules. Its CAS number, 302-72-7, is used for identification in chemical databases.
Formula:C3H7NO2
InChI:InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)
InChI key:InChIKey=QNAYBMKLOCPYGJ-UHFFFAOYSA-N
SMILES:O=C(O)C(N)C
- Synonyms:
- (.+-.)-2-Aminopropionic acid
- (.+-.)-Alanine
- (R,S)-Alanine
- 2-Amino-propionic acid
- 2-Aminopropanoic acid
- <span class="text-smallcaps">DL</span>-Ala
- <span class="text-smallcaps">DL</span>-Alanine
- <span class="text-smallcaps">DL</span>-α-Alanine
- <span class="text-smallcaps">DL</span>-α-Aminopropionic acid
- Alanine, <span class="text-smallcaps">DL</span>-
- See more synonyms
- Alanine, Dl-
- DL-2-Amino Propanoic Acid
- DL-2-Aminopropanoic acid
- DL-2-Aminopropionic acid
- DL-Ala
- DL-Alanin
- DL-Alanine (1.00963)
- DL-alanina
- DL-α-Alanine
- DL-α-Aminopropionic acid
- H-DL-Ala-OH
- Nsc 7602
- DL-Alanine
