CAS 3020-09-5
:Robinetinidin
Description:
Robinetinidin is a flavonoid compound belonging to the class of anthocyanidins, which are known for their vibrant colors and antioxidant properties. It is characterized by its chemical structure, which includes a chromone backbone with hydroxyl groups that contribute to its reactivity and solubility in various solvents. This compound is often found in various plant species and is associated with potential health benefits, including anti-inflammatory and antioxidant activities. Robinetinidin can exhibit different colors depending on the pH of the environment, making it of interest in both natural dye applications and food science. Its presence in fruits and flowers contributes to the pigmentation and may play a role in attracting pollinators. Additionally, research into its biological activities suggests that it may have implications in the prevention of certain diseases, although further studies are needed to fully understand its mechanisms and potential therapeutic uses. Overall, robinetinidin is a notable compound in the field of natural products and phytochemistry.
Formula:C15H11O6·Cl
InChI:InChI=1S/C15H10O6.ClH/c16-9-2-1-7-3-12(19)15(21-13(7)6-9)8-4-10(17)14(20)11(18)5-8;/h1-6H,(H4-,16,17,18,19,20);1H
InChI key:InChIKey=SSFSVCKWRJIXDS-UHFFFAOYSA-N
SMILES:OC=1C(=[O+]C2=C(C1)C=CC(O)=C2)C3=CC(O)=C(O)C(O)=C3.[Cl-]
Synonyms:- 1-Benzopyrylium, 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride
- 1-Benzopyrylium, 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1)
- 3,3′,4′,5′,7-Pentahydroxyflavylium chloride
- 3,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)chromeniumchlorid
- Flavylium, 3,3′,4′,5′,7-pentahydroxy-, chloride
- Robinetinidin
- Robinetinidin chloride
- Robinetinidol chloride
- 3,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Robinetinidin chloride
CAS:Robinetinidin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C15H11O6ClPurity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:322.68Robinetinidin chloride
CAS:Robinetinidin chloride is a natural product for research related to life sciences. The catalog number is TN6622 and the CAS number is 3020-09-5.
Formula:C15H11ClO6Purity:98%Color and Shape:SolidMolecular weight:322.7Robinetinidin chloride
CAS:Robinetinidin chloride is a type of flavonoid compound, specifically an anthocyanidin, which is derived from natural plant sources. This compound is primarily extracted from the heartwood and bark of certain tree species, such as robinia, and is a product of the plant's secondary metabolism.
Formula:C15H11ClO6Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:322.7 g/mol


