CAS 3020-09-5: Robinetinidin

Description:Robinetinidin is a flavonoid compound belonging to the class of anthocyanidins, which are known for their vibrant colors and antioxidant properties. It is characterized by its chemical structure, which includes a chromone backbone with hydroxyl groups that contribute to its reactivity and solubility in various solvents. This compound is often found in various plant species and is associated with potential health benefits, including anti-inflammatory and antioxidant activities. Robinetinidin can exhibit different colors depending on the pH of the environment, making it of interest in both natural dye applications and food science. Its presence in fruits and flowers contributes to the pigmentation and may play a role in attracting pollinators. Additionally, research into its biological activities suggests that it may have implications in the prevention of certain diseases, although further studies are needed to fully understand its mechanisms and potential therapeutic uses. Overall, robinetinidin is a notable compound in the field of natural products and phytochemistry.

Formula:C₁₅H₁₁O₆·Cl

InChI:InChI=1S/C15H10O6.ClH/c16-9-2-1-7-3-12(19)15(21-13(7)6-9)8-4-10(17)14(20)11(18)5-8;/h1-6H,(H4-,16,17,18,19,20);1H

InChI key:InChIKey=SSFSVCKWRJIXDS-UHFFFAOYSA-N

SMILES:[Cl-].OC=1C=CC=2C=C(O)C(=[O+]C2C1)C=3C=C(O)C(O)=C(O)C3

Synonyms:
1-Benzopyrylium, 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride
1-Benzopyrylium, 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1)
3,3′,4′,5′,7-Pentahydroxyflavylium chloride
3,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)chromeniumchlorid
Flavylium, 3,3′,4′,5′,7-pentahydroxy-, chloride
Robinetinidin
Robinetinidin chloride
Robinetinidol chloride
3,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Robinetinidin chloride REF: 11-0927SCAS: 3020-09-5	(HPLC) ≥95%	220.00 €	Wed 09 Apr 25
Robinetinidin chloride REF: TM-TN6622CAS: 3020-09-5	98%	To inquire	Tue 15 Apr 25
Robinetinidin chloride REF: 3D-FR65448CAS: 3020-09-5	Min. 95%	184.00 €~2,343.00 €	Fri 25 Apr 25