CAS 30216-44-5
:2-bromobenzenecarbothioamide
Description:
2-Bromobenzenecarbothioamide, with the CAS number 30216-44-5, is an organic compound characterized by the presence of a bromine atom and a thioamide functional group attached to a benzene ring. This compound features a bromine substituent at the second position of the benzene ring, which influences its reactivity and physical properties. Thioamides, in general, are known for their ability to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The presence of the bromine atom can enhance the electrophilicity of the aromatic system, making it more reactive towards nucleophiles. In terms of physical properties, 2-bromobenzenecarbothioamide is likely to be a solid at room temperature, with moderate solubility in organic solvents. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry and material science. Overall, this compound exemplifies the diverse chemistry associated with halogenated aromatic thioamides.
Formula:C7H6BrNS
InChI:InChI=1/C7H6BrNS/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H2,9,10)
SMILES:c1ccc(c(c1)C(=N)S)Br
Synonyms:- Benzenecarbothioamide, 2-bromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromothiobenzamide
CAS:Formula:C7H6BrNSPurity:99%(LC-MS);RGColor and Shape:SolidMolecular weight:216.12-Bromothiobenzamide
CAS:<p>2-Bromothiobenzamide is an organic solvent that is used as a reactant in the production of 2-bromothiolane. It is synthesized from the reaction of bromine with thiourea, which is then hydrolyzed to form the desired product. The reaction system is acidic, which leads to high yields and can be carried out on a large scale. It has a ligand that reacts with copper metal to form a reagent that can be used for the synthesis of various organic compounds. This product has a high yield (90%), and can be easily purified by filtration. Its efficiency makes it an ideal choice for industrial use.</p>Formula:C7H6BrNSPurity:Min. 95%Molecular weight:216.1 g/mol



