CAS 30216-44-5: 2-bromobenzenecarbothioamide
Description:2-Bromobenzenecarbothioamide, with the CAS number 30216-44-5, is an organic compound characterized by the presence of a bromine atom and a thioamide functional group attached to a benzene ring. This compound features a bromine substituent at the second position of the benzene ring, which influences its reactivity and physical properties. Thioamides, in general, are known for their ability to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The presence of the bromine atom can enhance the electrophilicity of the aromatic system, making it more reactive towards nucleophiles. In terms of physical properties, 2-bromobenzenecarbothioamide is likely to be a solid at room temperature, with moderate solubility in organic solvents. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry and material science. Overall, this compound exemplifies the diverse chemistry associated with halogenated aromatic thioamides.
Formula:C7H6BrNS
InChI:InChI=1/C7H6BrNS/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H2,9,10)
- Synonyms:
- Benzenecarbothioamide, 2-bromo-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-Bromobenzothioamide REF: IN-DA003GT4CAS: 30216-44-5 | 97% | To inquire | Mon 28 Apr 25 |
 | 2-Bromothiobenzamide REF: 54-OR49001CAS: 30216-44-5 | - - - | To inquire | Tue 29 Apr 25 |
 | 2-Bromothiobenzamide REF: 10-F021313CAS: 30216-44-5 | 98.0% | To inquire | Tue 06 May 25 |
 | 2-Bromothiobenzamide REF: 3D-FBA21644CAS: 30216-44-5 | Min. 95% | To inquire | Tue 10 Jun 25 |
2-Bromobenzothioamide
Ref: IN-DA003GT4
| 1g | 166.00 € | ||
| 250mg | 78.00 € |
2-Bromothiobenzamide
Ref: 10-F021313
| 1g | To inquire | ||
| 5g | To inquire | ||
| 25g | To inquire | ||
| 100mg | To inquire | ||
| 250mg | To inquire |
2-Bromothiobenzamide
Ref: 3D-FBA21644
| 5g | 447.00 € |
