CAS 30216-57-0
:1,3-Thiazole-2-carbonyl chloride
Description:
1,3-Thiazole-2-carbonyl chloride is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride. It typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of the carbonyl chloride group indicates that it can undergo nucleophilic acyl substitution reactions, making it useful in organic synthesis, particularly for the preparation of amides and esters. The thiazole moiety contributes to its potential biological activity, as thiazole derivatives are often found in pharmaceuticals and agrochemicals. Additionally, 1,3-thiazole-2-carbonyl chloride is sensitive to moisture and should be handled with care, as it can hydrolyze to form the corresponding carboxylic acid. Its reactivity and structural features make it a valuable intermediate in the synthesis of various chemical compounds.
Formula:C4H2ClNOS
InChI:InChI=1/C4H2ClNOS/c5-3(7)4-6-1-2-8-4/h1-2H
SMILES:c1csc(C(=O)Cl)n1
Synonyms:- 2-Thiazolecarbonyl Chloride
- 1,3-Thiazole-2-carbonyl chloride
- 1,3-Thiazole-2-carbonyl chloride 97%
- 2-Thiazolecarbonyl chloride (8CI,9CI)
- 2-Thiazolecarbonyl chloride (8CI, 9CI, ACI)
- 1,3-Thiazole-2-carbonylchloride97%
- thiazole-2-carbonyl chloride
- 2-(Chlorocarbonyl)-1,3-thiazole, 2-(Chloroformyl)-1,3-thiazole
- 1,3-Thiazole-2-carbonyl chloride ,95%
- 2-(Chlorocarbonyl)-1,3-thiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,3-Thiazole-2-carbonyl chloride
CAS:1,3-Thiazole-2-carbonyl chlorideFormula:C4H2ClNOSPurity:95%Color and Shape: solidMolecular weight:147.58g/mol1,3-Thiazole-2-carbonyl chloride
CAS:Formula:C4H2ClNOSPurity:95%Color and Shape:SolidMolecular weight:147.581,3-Thiazole-2-carbonyl chloride
CAS:<p>1,3-Thiazole-2-carbonyl chloride is a hydrogen chloride with an amide and thionyl group. It is used in the synthesis of alicyclic compounds. 1,3-Thiazole-2-carbonyl chloride can be chlorinated to produce a chlorinating agent. This compound has been shown to have oncologic properties and can cause cancer in target cells by binding to the tyrosine kinase enzyme. It is also orally active and aromatic hydrocarbon.</p>Formula:C4H2ClNOSPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:147.58 g/mol


