CAS 3022-92-2

malformin A from aspergillus niger

Description:

Malformin A is a secondary metabolite produced by the fungus Aspergillus niger, classified as a cyclic peptide. It is known for its unique structure, which consists of a cyclic arrangement of amino acids, contributing to its biological activity. Malformin A exhibits notable antifungal and antibacterial properties, making it of interest in pharmaceutical and agricultural applications. The compound has been studied for its potential use in controlling plant pathogens and as a model for developing new antimicrobial agents. Its mechanism of action is thought to involve interference with cellular processes in target organisms. Additionally, malformin A has been investigated for its effects on mammalian cells, although its safety and toxicity profiles require careful consideration. As a chemical entity, it is characterized by its specific molecular formula and weight, which are essential for understanding its reactivity and interactions. Overall, malformin A represents a significant example of natural products derived from fungi with potential applications in various fields.

Formula: C₂₃H₃₉N₅O₅S₂

InChI: InChI=1/C23H39N5O5S2/c1-7-13(6)18-23(33)26-15-9-34-35-10-16(25-20(15)30)21(31)27-17(12(4)5)22(32)24-14(8-11(2)3)19(29)28-18/h11-18H,7-10H2,1-6H3,(H,24,32)(H,25,30)(H,26,33)(H,27,31)(H,28,29)

SMILES: CCC(C)C1C(=NC2CSSCC(C(=NC(C(C)C)C(=NC(CC(C)C)C(=N1)O)O)O)N=C2O)O

Synonyms:

• Malformins
• Malformin A1
• Nsc 324646
• Cyclic(D-cysteinyl-D-cysteinyl-L-valyl-D-leucyl-L-isoleucyl)cyclic(1-2)-disulfide
• Malformin A
• 4-(Butan-2-Yl)-7-(2-Methylpropyl)-10-(Propan-2-Yl)-15,16-Dithia-2,5,8,11,19-Pentaazabicyclo[11.4.2]Nonadecane-3,6,9,12,18-Pentone

Malformin-A1; Malformin-A

CAS: 3022-92-2

Formula: C₂₃H₃₉N₅O₅S₂

Purity: 76.84%

Color and Shape: White. Solid

Molecular weight: 530.0

Ref: 8R-CH0057

Malformin A

CAS: 3022-92-2

Malformin A, from A. niger, is a plant growth regulator and has anti-TMV and cancer cell cytotoxic properties. Intraperitoneal LD50 in mice is 3.1 mg/kg.

Formula: C₂₃H₃₉N₅O₅S₂

Color and Shape: Solid

Molecular weight: 529.72

Ref: TM-T36489

Malformin A1

CAS: 3022-92-2

Formula: C₂₃H₃₉N₅O₅S₂

Molecular weight: 529.7

Ref: 7W-GL8069

Malformin A1

CAS: 3022-92-2

Malformin A1 is a mycotoxin, which is a secondary metabolite produced by certain fungi. This compound is predominantly sourced from a species of the genus *Aspergillus*, specifically *Aspergillus niger*. Malformin A1's mode of action involves disrupting cellular processes by interfacing with certain cellular proteins, leading to morphological changes and inhibition of various biochemical activities.

Formula: C₂₃H₃₉N₅O₅S₂

Purity: Min. 95%

Molecular weight: 529.7 g/mol

Ref: 3D-DAA02292