CAS 30222-00-5
:6-(2,5-dichlorophenyl)-1,3,5-triazine-2,4(1H,3H)-dione
Description:
6-(2,5-Dichlorophenyl)-1,3,5-triazine-2,4(1H,3H)-dione, with the CAS number 30222-00-5, is a chemical compound characterized by its triazine core, which is a six-membered heterocyclic ring containing three nitrogen atoms. This compound features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring, which contributes to its chemical reactivity and potential biological activity. The presence of the dione functional groups (two carbonyl groups) enhances its ability to participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. This compound is often studied for its potential applications in agrochemicals, pharmaceuticals, and materials science due to its unique structural properties. Additionally, its stability and solubility characteristics can vary based on the solvent and environmental conditions, making it a subject of interest in both synthetic and applied chemistry. Overall, the combination of its triazine structure and substituents gives it distinctive properties that are valuable in various chemical applications.
Formula:C9H5Cl2N3O2
InChI:InChI=1/C9H5Cl2N3O2/c10-4-1-2-6(11)5(3-4)7-12-8(15)14-9(16)13-7/h1-3H,(H2,12,13,14,15,16)
Synonyms:- 6-(2,5-dichlorophenyl)-1,3,5-Triazine-2,4(1H,3H)-dione
- Isoladine maleate impurity SQJ
- 1,3,5-Triazine-2,4(1H,3H)-dione, 6-(2,5-dichlorophenyl)-
- Irsogladine Impurity SQJ
- Irsogladine Impurity 9
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Irsogladine Impurity 1
CAS:Formula:C9H5Cl2N3O2Color and Shape:White To Off-White SolidMolecular weight:258.06
