CAS 3023-49-2

(+/-)-1-(9-fluorenyl)ethanol

Description:

(+/-)-1-(9-fluorenyl)ethanol, with the CAS number 3023-49-2, is an organic compound characterized by its chiral structure, which includes a fluorenyl group attached to an ethanol moiety. This compound exists as a racemic mixture, meaning it contains equal amounts of both enantiomers, which can exhibit different optical activities. The fluorenyl group contributes to its hydrophobic characteristics, while the hydroxyl (-OH) group of the ethanol part provides polar properties, making it soluble in polar solvents. This compound is often utilized in organic synthesis and as a chiral auxiliary in asymmetric synthesis due to its ability to influence the stereochemistry of reactions. Additionally, its unique structure allows for potential applications in materials science and pharmaceuticals, where chirality plays a crucial role in the efficacy and safety of drug compounds. The compound's stability and reactivity can be influenced by various factors, including temperature and the presence of other reagents, making it a subject of interest in both academic and industrial research.

Formula: C₁₅H₁₄O

InChI: InChI=1/C15H14O/c1-10(16)15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-10,15-16H,1H3

SMILES: CC(C1c2ccccc2c2ccccc12)O

Synonyms:

• 1-(9H-fluoren-9-yl)ethanol
• ()-1-(9-Fluorenyl)ethanol

1-(9H-Fluoren-9-yl)ethanol

CAS: 3023-49-2

Formula: C₁₅H₁₄O

Purity: 95%

Color and Shape: Solid

Molecular weight: 210.2711

Ref: IN-DA003BDX

1-(9H-Fluoren-9-yl)ethanol

CAS: 3023-49-2

Formula: C₁₅H₁₄O

Molecular weight: 210.28

Ref: 4Z-A-233005

(±)-1-(9-Fluorenyl)ethanol

Controlled Product

CAS: 3023-49-2

Applications (±)-1-(9-Fluorenyl)ethanol is used as a reagent in the preparation of fluorenylethanol via enzymic kinetic resolution by transesterification using lipase.
References Borowiecki, P., et al.: Tetrahedron Asymmetry, 24, 1120 (2013)

Formula: C₁₅H₁₄O

Color and Shape: Neat

Molecular weight: 255.269

Ref: TR-F647650