CAS 30233-64-8
:Glyceryl monobehenate
Description:
Glyceryl monobehenate, with the CAS number 30233-64-8, is a chemical compound that belongs to the class of glyceryl esters. It is derived from glycerol and behenic acid, a long-chain fatty acid. This substance is typically characterized by its waxy texture and is often used as an emulsifier, stabilizer, and thickening agent in various formulations, particularly in the cosmetic and pharmaceutical industries. Glyceryl monobehenate is known for its ability to enhance the texture and stability of creams and lotions, making it a valuable ingredient in personal care products. Additionally, it exhibits good compatibility with a wide range of other ingredients, which contributes to its versatility in formulations. The compound is generally regarded as safe for use in cosmetics and food products, although specific regulatory guidelines should be followed. Its hydrophobic nature allows it to form stable emulsions, which is crucial for maintaining the desired consistency and performance of topical applications.
Formula:C25H50O4
InChI:InChI=1/C25H50O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)29-24(22-26)23-27/h24,26-27H,2-23H2,1H3
SMILES:CCCCCCCCCCCCCCCCCCCCCC(=O)OC(CO)CO
Synonyms:- 1,3-Dihydroxypropan-2-Yl Docosanoate
- 2,3-Dihydroxypropyl docosanoate
- B 100
- B 100A
- Behenic acid monoglyceride
- Behenic monoglyceride
- Compritol E-ATO
- Dimodan-MB 90
- Docosanoic acid, 2,3-dihydroxypropyl ester
- Docosanoic acid, monoester with 1,2,3-propanetriol
- Docosanoin, mono-
- Emalsy B 100
- Exceparl G-MB
- Glycerin monobehenate
- Glycerine monobehenate
- Glycerol monobehenate
- Glyceryl behenate
- Glyceryl monobehenate
- Glyceryl monodocosanoate
- Kemester 6500
- Monobehenin
- Poem B 100
- Rikemal B 100
- Rikemal B 100P
- Sunsoft 8100
- Sunsoft 8100C
- Docosanoic acid, monoester with glycerol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Monobehenin
CAS:Monobehenin has a strong inhibitory effect on the formation of bacterial biofilm.
Formula:C25H52O5Purity:97.63%Color and Shape:SolidMolecular weight:432.68



