CAS 30235-17-7
:3-Methyl-4-nitro-2-pyridinecarboxylic acid
Description:
3-Methyl-4-nitro-2-pyridinecarboxylic acid, with the CAS number 30235-17-7, is an organic compound that features a pyridine ring substituted with a methyl group, a nitro group, and a carboxylic acid functional group. This compound is characterized by its aromatic nature due to the presence of the pyridine ring, which contributes to its chemical stability and reactivity. The nitro group is a strong electron-withdrawing group, which can influence the acidity of the carboxylic acid and the overall reactivity of the molecule. The presence of the methyl group provides steric hindrance and can affect the compound's solubility and interaction with other molecules. Typically, compounds like this may exhibit moderate to high solubility in polar solvents due to the carboxylic acid group, while the aromatic nature may impart some degree of hydrophobic character. Additionally, 3-Methyl-4-nitro-2-pyridinecarboxylic acid may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility in synthetic chemistry.
Formula:C7H6N2O4
InChI:InChI=1S/C7H6N2O4/c1-4-5(9(12)13)2-3-8-6(4)7(10)11/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=CSLIOHVICYQKHA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C(N(=O)=O)=CC=N1
Synonyms:- 3-Methyl-4-nitropicolinic acid
- 3-Methyl-4-nitro-2-pyridinecarboxylic acid
- 2-Pyridinecarboxylic acid, 3-methyl-4-nitro-
- Picolinic acid, 3-methyl-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
