CAS 30235-26-8
:4-(pyridin-2-yl)-1,3-thiazol-2-amine
Description:
4-(Pyridin-2-yl)-1,3-thiazol-2-amine, with the CAS number 30235-26-8, is a heterocyclic compound featuring both a thiazole and a pyridine moiety. This compound typically exhibits characteristics common to nitrogen-containing heterocycles, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of amino and nitrogen atoms. The thiazole ring contributes to its reactivity, particularly in nucleophilic substitution reactions, while the pyridine ring can influence its electronic properties and interactions with biological targets. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural features suggest potential applications in various fields, including agrochemicals and materials science. The presence of both aromatic and heteroaromatic systems often leads to interesting photophysical properties, which can be exploited in dye or sensor applications. Overall, 4-(pyridin-2-yl)-1,3-thiazol-2-amine is a versatile compound with significant potential for further research and application.
Formula:C8H7N3S
InChI:InChI=1/C8H7N3S/c9-8-11-7(5-12-8)6-3-1-2-4-10-6/h1-5H,(H2,9,11)
SMILES:c1ccnc(c1)c1csc(=N)[nH]1
Synonyms:- 2-Thiazolamine, 4-(2-pyridinyl)-
- 4-(Pyridin-2-Yl)Thiazol-2-Amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-4-(2-pyridyl)thiazole, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H7N3SPurity:97%Molecular weight:177.222-Thiazolamine, 4-(2-pyridinyl)-
CAS:Formula:C8H7N3SPurity:97%Color and Shape:SolidMolecular weight:177.22632-Amino-4-(2-pyridyl)thiazole
CAS:2-Amino-4-(2-pyridyl)thiazolePurity:≥95%Color and Shape:SolidMolecular weight:177.23g/mol2-Amino-4-(2-pyridyl)thiazole
CAS:Formula:C8H7N3SPurity:96%Color and Shape:SolidMolecular weight:177.23



