CAS 30235-28-0

4-(Pyridin-4-yl)-1,3-thiazol-2-amine

Description:

4-(Pyridin-4-yl)-1,3-thiazol-2-amine, with the CAS number 30235-28-0, is a heterocyclic organic compound characterized by the presence of both a pyridine and a thiazole ring in its structure. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The thiazole moiety contributes to its biological activity, often making it a subject of interest in medicinal chemistry for its potential pharmacological properties. The amino group (-NH2) at the thiazole position can participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. Additionally, the presence of the pyridine ring may enhance its electron-withdrawing characteristics, affecting its overall chemical behavior. This compound may be utilized in various applications, including drug development and as a building block in organic synthesis. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases for precise values.

Formula: C₈H₇N₃S

InChI: InChI=1/C8H7N3S/c9-8-11-5-7(12-8)6-1-3-10-4-2-6/h1-5H,(H2,9,11)

SMILES: c1cnccc1c1c[nH]c(=N)s1

Synonyms:

• 2-Thiazolamine, 4-(4-pyridinyl)-

2-Thiazolamine, 4-(4-pyridinyl)-

CAS: 30235-28-0

Formula: C₈H₇N₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 177.2263

Ref: IN-DA002ZC8

2-Amino-4-pyridin-4-yl-1,3-thiazole

CAS: 30235-28-0

2-Amino-4-pyridin-4-yl-1,3-thiazole

Formula: C₈H₇N₃S

Purity: 95%

Color and Shape: pale pink crystals/ powder

Molecular weight: 177.23g/mol

Ref: 54-OR2532

2-Amino-4-(4-pyridyl)thiazole

CAS: 30235-28-0

Formula: C₈H₇N₃S

Purity: 97%

Color and Shape: Liquid

Molecular weight: 177.23

Ref: 10-F017429