CAS 30235-47-3
:5-[3-(Dimethylamino)propyl]-5H-dibenzo[a,d]cycloheptene-3,5-diol
Description:
5-[3-(Dimethylamino)propyl]-5H-dibenzo[a,d]cycloheptene-3,5-diol, with CAS number 30235-47-3, is a chemical compound that belongs to the class of dibenzo[a,d]cycloheptenes. This substance features a complex polycyclic structure, characterized by the presence of a dimethylamino group and hydroxyl functional groups, which contribute to its chemical reactivity and potential biological activity. The dimethylamino group can enhance solubility in polar solvents and may influence the compound's pharmacological properties. The hydroxyl groups are likely to participate in hydrogen bonding, affecting the compound's interactions with other molecules. This compound may exhibit various properties such as lipophilicity, which can impact its absorption and distribution in biological systems. Additionally, its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and literature review.
Formula:C20H23NO2
InChI:InChI=1S/C20H23NO2/c1-21(2)13-5-12-20(23)18-7-4-3-6-15(18)8-9-16-10-11-17(22)14-19(16)20/h3-4,6-11,14,22-23H,5,12-13H2,1-2H3
InChI key:InChIKey=LVSOPRLYYPOIMB-UHFFFAOYSA-N
SMILES:C(CCN(C)C)C1(O)C=2C(C=CC=3C1=CC=CC3)=CC=C(O)C2
Synonyms:- 5H-Dibenzo[a,d]cycloheptene-3,5-diol, 5-[3-(dimethylamino)propyl]-
- 5-[3-(Dimethylamino)propyl]-5H-dibenzo[a,d]cycloheptene-3,5-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
3,5-Hydroxy-N-methylprotriptyline
CAS:Controlled ProductFormula:C20H23NO2Color and Shape:NeatMolecular weight:309.402


