CAS 30243-77-7
:1-cyclohexyl-3-methyl-1,3,5-triazinane-2,4,6-trione
Description:
1-Cyclohexyl-3-methyl-1,3,5-triazinane-2,4,6-trione, with CAS number 30243-77-7, is a chemical compound characterized by its triazine ring structure, which consists of alternating nitrogen and carbon atoms. This compound features a cyclohexyl group and a methyl group attached to the triazine framework, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the trione functional groups indicates that it can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may also display biological activity, making it of interest in fields such as pharmaceuticals or agrochemicals. Its stability, reactivity, and potential applications can vary based on environmental conditions such as pH and temperature. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C10H15N3O3
InChI:InChI=1/C10H15N3O3/c1-12-8(14)11-9(15)13(10(12)16)7-5-3-2-4-6-7/h7H,2-6H2,1H3,(H,11,14,15)
SMILES:Cn1c(nc(=O)n(C2CCCCC2)c1=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Cyclohexyl-3-methyl-1,3,5-triazinane-2,4,6-trione
CAS:Controlled ProductFormula:C10H15N3O3Color and Shape:White To Off-WhiteMolecular weight:225.24Hexazinone metabolite D
CAS:Hexazinone metabolite D is a derivative compound that results from the biotransformation of Hexazinone, which is a systemic herbicide. This metabolite originates from the breakdown processes mediated by biological or environmental factors in ecosystems where Hexazinone is applied. Its mode of action involves the inhibition of photosynthesis by targeting photosystem II, ultimately reducing the transfer of electrons, which leads to the disruption of energy production in susceptible plant species.
Formula:C10H15N3O3Purity:Min. 95%Molecular weight:225.24 g/mol


