CAS 30248-47-6
:azetidin-2-ylcarbonyl nitrite
Description:
Azetidin-2-ylcarbonyl nitrite, with the CAS number 30248-47-6, is a chemical compound characterized by its unique structural features. It contains an azetidine ring, which is a four-membered saturated heterocyclic compound, and a carbonyl group attached to the nitrogen atom of the azetidine. The presence of the nitrite functional group (-ONO) adds to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its reactivity is influenced by the electron-withdrawing nature of the nitrite group, which can participate in various chemical reactions, including nucleophilic attacks and rearrangements. Azetidin-2-ylcarbonyl nitrite may be utilized in the synthesis of more complex organic molecules and could have implications in medicinal chemistry, although specific biological activities would require further investigation. As with many nitrogen-containing compounds, it should be handled with care due to potential toxicity and reactivity.
Formula:C4H6N2O3
InChI:InChI=1/C4H6N2O3/c7-4(9-6-8)3-1-2-5-3/h3,5H,1-2H2
SMILES:C1CNC1C(=O)ON=O
Synonyms:- 1-Nitroso-2(S)-azetidinecarboxylic Acid
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
2-Azetidinecarboxylic acid, 1-nitroso-, (2S)-
CAS:Formula:C4H6N2O3Color and Shape:SolidMolecular weight:130.102N-Nitroso-L-azetidine-2-Carboxylic Acid
CAS:Controlled ProductApplications N-Nitroso-L-azetidine-2-Carboxylic Acid (cas# 30248-47-6) is a compound useful in organic synthesis.
References Lijinsky, W., et al.: Tetrahedron, 26, 5137 (1970)Formula:C4H6N2O3Color and Shape:NeatMolecular weight:130.1N-Nitroso-L-(azetidine-d5)-2-carboxylic Acid
CAS:Controlled ProductFormula:C4HD5N2O3Color and Shape:NeatMolecular weight:135.13



