CAS 30269-02-4
:1-Amino-8-nitropyrene
Description:
1-Amino-8-nitropyrene is an organic compound that belongs to the class of nitroaromatic compounds, characterized by the presence of both amino and nitro functional groups attached to a pyrene backbone. This compound typically exhibits a yellow to orange color and is known for its potential mutagenic and carcinogenic properties, which are common among nitro-substituted polycyclic aromatic hydrocarbons (PAHs). The amino group provides basic properties, while the nitro group contributes to its reactivity and ability to participate in electrophilic substitution reactions. 1-Amino-8-nitropyrene is often studied for its environmental impact, particularly in relation to air pollution and its formation from combustion processes. Its solubility in organic solvents and limited solubility in water can influence its behavior in biological systems and the environment. Safety precautions are essential when handling this compound due to its toxicological profile, and it is subject to regulations concerning hazardous substances. Overall, 1-amino-8-nitropyrene serves as an important compound in both environmental chemistry and toxicology research.
Formula:C16H10N2O2
InChI:InChI=1S/C16H10N2O2/c17-13-7-3-9-1-2-10-4-8-14(18(19)20)12-6-5-11(13)15(9)16(10)12/h1-8H,17H2
InChI key:InChIKey=WGVCNGPAJHVJKK-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C3=C4C(C=C2)=C(N)C=CC4=CC=C3C=C1
Synonyms:- 1-Amino-8-nitropyrene
- 8-Nitro-1-pyrenamine
- 1-Pyrenamine, 8-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
